Гликоза: Разлика помеѓу преработките

[непроверена преработка][проверена преработка]
Избришана содржина Додадена содржина
с r2.7.2) (Бот Додава: xmf:გლუკოზა
сНема опис на уредувањето
Ред 1:
{{Без извори|датум=ноември 2009}}
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 464190891
| Name = <small>D</small>-глукоза
| ImageFile1 = Glucose chain structure.svg
| ImageSize1 = 180
| ImageCaption1 =
| ImageFile2 = D-glucose-chain-3D-balls.png
| ImageSize2 = 180
| ImageCaption2 =
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-2,3,4,5,6-Pentahydroxyhexanal
| OtherNames = Blood sugar<br />Dextrose<br />Corn sugar<br /><small>D</small>-Glucose<br />Grape sugar
| Section1 = {{Chembox Identifiers
| Abbreviations = Glc
| CASNo = 50-99-7
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 5793
| PubChem_Ref = {{Pubchemcite|correct|PubChem}}
| ChemSpiderID = 5589
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = 5SL0G7R0OK
| UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1222250
| EINECS = 200-075-1
| MeSHName = Glucose
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 4167
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C00031
| RTECS = LZ6600000
| ATCCode_prefix = B05
| ATCCode_suffix = CX01
| ATC_Supplemental = {{ATC|V04|CA02}}, {{ATC|V06|DC01}}
| SMILES = OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O
| SMILES1 = C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C12H24O12/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1
| InChI = 1/C12H24O12/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WQZGKKKJIJFFOK-GASJEMHNSA-N
| InChIKey = WQZGKKKJIJFFOK-DVKNGEFBBQ
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>6</sub>H<sub>12</sub>O<sub>6</sub>
| MolarMass = 180.16 g/mol
| ExactMass = 180.063388
| MeltingPt = α-<small>D</small>-glucose: 146&nbsp;°C<br />β-<small>D</small>-glucose: 150&nbsp;°C
| Density = 1.54&nbsp;g/cm<sup>3</sup>
| Solubility = 91&nbsp;g/100&nbsp;mL
}}
| Section3 = {{Chembox Thermochemistry
| Reference = <ref>{{citation | last1 = Ponomarev | first1 = V. V. | last2 = Migarskaya | first2 = L. B. | title = Heats of combustion of some amino-acids | journal = Russ. J. Phys. Chem. (Engl. Transl.) | year = 1960 | volume = 34 | pages = 1182–83}}. {{citation | last = Boerio-Goates | first = Juliana | title = Heat-capacity measurements and thermodynamic functions of crystalline α-D-glucose at temperatures from 10K to 340K | journal = J. Chem. Thermodynam. | year = 1991 | volume = 23 | issue = 5 | pages = 403–9 | doi = 10.1016/S0021-9614(05)80128-4}}.</ref>
| DeltaHf = −1271&nbsp;kJ/mol
| DeltaHc = −2805&nbsp;kJ/mol
| Entropy = 209.2&nbsp;J&thinsp;K<sup>−1</sup>&thinsp;mol<sup>−1</sup>
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS = [http://www.inchem.org/documents/icsc/icsc/eics0865.htm ICSC 0865]
| EUIndex = not listed
}}
}}
'''Глукозата''' (С<sub>6</sub>H<sub>12</sub>O<sub>6</sub>) претставува гроздов шеќер. Таа се наоѓа и во [[крв]]та на [[животни]]те, каде што има многубројни функции. Се складира во [[Црн дроб|црниот дроб]] во вид резервен шеќер-[[гликоген]]. Кога резервите на јаглехидратите во [[Организам|организмот]] се празни, црниот дроб врши [[конверзија]] на гликогенот во глукоза со што се подмируваат потребите за енергија. При најразлични [[Концентрација|концентрации]] на глукоза во организмот, настануваат [[хипергликемија]] или [[хипогликемија]].
 
Преземено од „https://mk.wikipedia.org/wiki/Гликоза