Разлика помеѓу преработките на „Аденозин трифосфат“

с
нема опис на уредувањето
с
{{Без извори|датум=октомври 2009}}
{{chembox
[[Податотека:ATP_chemical_structure.png|десно|350п|Аденозин трифосфат (АТФ)]]
| verifiedrevid = 390928017
| Name = Аденозин трифосфат
| ImageFile = ATP structure.svg
| ImageName = Skeletal formula of ATP
| ImageFile1 = ATP-xtal-3D-balls.png
| ImageName1 = Ball-and-stick model, based on x-ray diffraction data
| ImageFile2 = Atp exp.qutemol-ball.png
| ImageSize2 = 180px
| ImageName2 = Space-filling model with hydrogen atoms omitted
| IUPACName = [(2''R'',3''S'',4''R'',5''R'')-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl(hydroxyphosphonooxyphosphoryl)hydrogen phosphate
| OtherNames = аденозин 5'-(тетрахидроген трифосфат)
| Section1 = {{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8L70Q75FXE
| InChI = 1/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
| SMILES = O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3O
| InChIKey = ZKHQWZAMYRWXGA-KQYNXXCUBG
| PubChem = 5957
| IUPHAR_ligand = 1713
| SMILES1 = c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO[P@@](=O)(O)O[P@@](=O)(O)OP(=O)(O)O)O)O)N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 56-65-5
| ChemSpiderID = 5742
}}
| Section2 = {{Chembox Properties
| C=10|H=16|N=5|O=13|P=3
| MolarMass = 507.18 g/mol
| MeltingPt = 187 °C (динатриумова сол) <br> ''decomposes''
| Density = 1.04 g/cm<sup>3</sup> (disodium salt)
| pKa = 6.5
}}
}}
 
'''Аденозин трифосфатот''' ('''АТФ''' или '''ATP''') е високоенергетско [[Хемиско соединение|соединение]] кое дава [[енергија]] на повеќето [[живот]]ни процеси кај [[Организам|организмите]]. АТФ е [[нуклеотид]], познат во [[биохемија]]та како „[[молекула|молекуларна]] валута“ за внатрешноклеточниот пренос на [[енергија]]та; односно, АТФ е во состојба да складира и пренесува енергија внатре во [[клетка]]та. АТФ исто така игра важна улога во [[синтеза]]та на [[Нуклеинска киселина|нуклеинските киселини]]. Молекулите на АТФ се користат и за депонирање на корисна енергија, која [[растенија]]та ја конвертираат во процесот на [[клеточно дишење]].