Тестостерон: Разлика помеѓу преработките

Додадени 4.240 бајти ,  пред 12 години
нема опис на уредувањето
[непроверена преработка][непроверена преработка]
с (Бот додава Шаблон: Без извори)
Нема опис на уредувањето
{{Drugbox| Watchedfields = changed
{{Без извори|датум=ноември 2009}}
| verifiedrevid = 265997766
'''Тестостеронот''' е машки полов хормон кој ги дава повеќето машки [[полови карактеристики]]. Се [[Синтеза|синтетизира]] во [[семеници]]те. Лачењето на тестостеронот започнува во текот на [[Фетус|феталниот]] и [[Ембрион|ембрионалниот]] период, при што лачењето се поврзува со поместувањето на [[тестис]]ите од [[Стомак|стомачната]] празнина во [[мошници]]те. Во [[пубертет]]от, лачењето се зголемува, додека околу 40-сеттата година од [[живот]]от значително се намалува, но тој сепак продолжува да се лачи до крајот на животот. Неговото излачување е под контрола на [[Гонадотропни хормони|гонадотропните хормони]] од [[хипофиза]]та.
| IUPAC_name =
| image = Testosterone.svg
| width = 200px
| image2=Testosterone-from-xtal-3D-balls.png
| smiles=C[C@]43CCC(=O)\C=C4\CC[C@@H]1[C@@H]3CC[C@]2(C)[C@@H](O)CC[C@@H]12
| CAS_number=58-22-0
| CASNo_Ref = {{cascite}}
| CAS_supplemental = <br/> 57-85-2 (пропионатен естер) <!-- Also CAS verified -->
| ChemSpiderID = 5791
| ATC_prefix=G03
| ATC_suffix=BA03
| ATC_supplemental=
| PubChem=6013
| DrugBank=
| C=19 | H=28 | O=2
| molecular_weight = 288,42
| bioavailability= ниска
| metabolism = [[Црн дроб]], [[Тестиси]] и [[Простата]]
| elimination_half-life= 2-4 часа
| excretion = [[Urine]] (90%), feces (6%)
| pregnancy_category = X ([[United States|USA]]), [[Тератогени ефекти]]
| legal_status = Schedule III ([[Акт за контролирани супстнаци|САД]])<br />Schedule IV ([[Акт за контролирани лекови и супстнаци|Канада]])
| routes_of_administration=Интрамускуларно, трансдермално (креми, гелови и др.),
| melting_point =155
| melting_high =156
| specific_rotation=+110,2°
| sec_combustion=−11080 kJ/mol
}}
 
'''Тестостеронот''' е машки полов хормон кој ги дава повеќето машки [[полови карактеристики]].<ref name="pmid3549275"/> Се [[Синтеза|синтетизира]] во [[семеници]]те. Лачењето на тестостеронот започнува во текот на [[Фетус|феталниот]] и [[Ембрион|ембрионалниот]] период, при што лачењето се поврзува со поместувањето на [[тестис]]ите од [[Стомак|стомачната]] празнина во [[мошници]]те. Во [[пубертет]]от, лачењето се зголемува, додека околу 40-сеттата година од [[живот]]от значително се намалува, но тој сепак продолжува да се лачи до крајот на животот. Неговото излачување е под контрола на [[Гонадотропни хормони|гонадотропните хормони]] од [[хипофиза]]та.
 
Во просек, возрасен маж синтетизира околу четириесет до шеесет пати повеќе тестостерон од возрасна женска, но жените се, од бихевиорална гледна точка, почувствителни на овој хормон.<ref name="isbn0-07-135739-4"/>
 
Тестостерон е зачуван како таков во текот на еволуцијата кај повеќето 'рбетници, иако рибите поседуваат малку поинаква форма која се нарекува 11-кетотестостерон.<ref name="isbn0-87893-617-3"/>
 
=== Биосинтеза ===
[[File:Steroidogenesis.svg|thumb|left|600px|Синтеза на стероидите во човековиот организам. Тестостеронот е прикажан на дното на сликата]]
 
==Литература==
{{наводи|refs=
 
<ref name="pmid3549275">{{cite journal | author = Mooradian AD, Morley JE, Korenman SG | title = Biological actions of androgens | journal = Endocr. Rev. | volume = 8 | issue = 1 | pages = 1–28 | year = 1987 | month = February | pmid = 3549275 | doi = 10.1210/edrv-8-1-1 | url = | issn = }}</ref>
 
<ref name="isbn0-87893-617-3">{{cite book | author = Nelson, Randy F. | authorlink = | editor = | others = | title = An introduction to behavioral endocrinology | edition = | language = | publisher = Sinauer Associates | location = Sunderland, Mass | year = 2005 | origyear = | pages = 143 | quote = | isbn = 0-87893-617-3 | oclc = | doi = | url = | accessdate = }}</ref>
 
<ref name="isbn0-07-135739-4">{{cite book | author = Dabbs M, Dabbs JM | authorlink = | editor = | others = | title = Heroes, rogues, and lovers: testosterone and behavior | edition = | language = | publisher = McGraw-Hill | location = New York | year = 2000 | origyear = | pages = | quote = | isbn = 0-07-135739-4 | oclc = | doi = | url = | accessdate = }}</ref>
}}
 
[[Категорија:Сексуалност]]
[[Категорија:Хормони]]
 
[[af:Testosteroon]]
[[als:Testosteron]]
[[ar:تستوستيرون]]
[[bs:Testosteron]]
[[br:Testosteron]]
[[bg:Тестостерон]]
[[ca:Testosterona]]
[[cv:Тестостерон]]
[[cs:Testosteron]]
[[da:Testosteron]]
[[de:Testosteron]]
[[et:Testosteroon]]
[[en:Testosterone]]
[[el:Τεστοστερόνη]]
[[es:Testosterona]]
[[eo:Testosterono]]
[[eu:Testosterona]]
[[fa:تستوسترون]]
[[fr:Testostérone]]
[[hr:Testosteron]]
[[id:Testosteron]]
[[it:Testosterone]]
[[he:טסטוסטרון]]
[[ku:Testosteron]]
[[la:Testosteronum]]
[[lt:Testosteronas]]
[[hu:Tesztoszteron]]
[[ms:Testosteron]]
[[nl:Testosteron]]
[[ja:テストステロン]]
[[no:Testosteron]]
[[oc:Testosterona]]
[[pl:Testosteron]]
[[pt:Testosterona]]
[[ro:Testosteron]]
[[ru:Тестостерон]]
[[simple:Testosterone]]
[[sk:Testosterón]]
[[sr:Тестостерон]]
[[sh:Testosteron]]
[[fi:Testosteroni]]
[[sv:Testosteron]]
[[tr:Testosteron]]
[[uk:Тестостерон]]
[[zh:睾酮]]