Разлика помеѓу преработките на „Оцетна киселина“

Додадени 782 бајти ,  пред 5 години
с
нема опис на уредувањето
(embed {{Нормативна контрола}} with wikidata information)
с
| SystematicName = Ethanoic acid
| OtherNames = Acetyl hydroxide (AcOH), Hydrogen acetate (HAc), Ethylic acid, Methanecarboxylic acid
| Section1 = {{Chembox Identifiers
| Abbreviations = AcOH
| CASNo = 64-19-7
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 171
| PubChem = 176
| SMILESChemSpiderID = CC(=O)O171
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/f/h3H
| UNII = Q40Q9N063P
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 200-580-7
| UNNumber = 2789
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB03166
| KEGG = D00010
| KEGG_Ref = {{keggcite|changed|kegg}}
| MeSHName = Acetic+acid
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15366
| ChEMBL = 539
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| IUPHAR_ligand = 1058
| ATCCode_prefix = G01
| ATCCode_suffix = AD02
| ATC_Supplemental = {{ATC|S02|AA10}}
| Beilstein = 506007
| Gmelin = 1380
| 3DMet = B00009
| RTECS = AF1225000
| SMILES = CC(O)=O
| InChIStdInChI =1 1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/f/h3H
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QTBSBXVTEAMEQO-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
| Section2 = {{Chembox Properties