Разлика помеѓу преработките на „Олеинска киселина“

с
нема опис на уредувањето
(embed {{Нормативна контрола}} with wikidata information)
с
| IUPACName = (9''Z'')-Octadec-9-enoic acid
| OtherNames = (9''Z'')-Octadecenoic acid<br />(''Z'')-Octadec-9-enoic acid<br />''cis''-9-Octadecenoic acid<br />''cis''-Δ<sup>9</sup>-Octadecenoic acid<br />Oleic acid<br />18:1 cis-9
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 1054
| SMILES = CCCCCCCC\C=C/CCCCCCCC(O)=O
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 8659
| CASNo = 112-80-1
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| RTECS =
| ChemSpiderID = 393217
| InChI = 1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-
| InChIKey = ZQPPMHVWECSIRJ-KTKRTIGZBB
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZQPPMHVWECSIRJ-KTKRTIGZSA-N
| RTECS =
}}
| Section2 = {{Chembox Properties