Разлика помеѓу преработките на „Фолна киселина“

Додадени 2.464 бајти ,  пред 9 години
с
нема опис на уредувањето
с (r2.6.5) (Бот Менува: ko:엽산)
с
{{chembox
[[Податотека:Folic_acid_structure.svg|мини|250px|Структурна формула на фолната киселина.]]
| Verifiedfields = changed
| verifiedrevid = 457481622
| Name = Фолна киселина
| ImageFile = Folicacid2.png
| ImageSize = 150px
| ImageName = Фолна киселина
| ImageFile1 = Folic_Acid_SFM.png
| ImageSize1 = 150px
| ImageName1 =
| ImageFile2 = Folic acid crystals.jpg
| ImageSize2 = 150px
| IUPACName = (2''S'')-2-[(4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid
| OtherNames = ''N''-&#x200b;(4-&#x200b;{[(2-&#x200b;amino-&#x200b;4-&#x200b;oxo-&#x200b;1,&#x200b;4-&#x200b;dihydropteridin-&#x200b;6-&#x200b;yl)&#x200b;methyl]&#x200b;amino}&#x200b;benzoyl)-&#x200b;<small>L</small>-&#x200b;glutamic acid; pteroyl-L-glutamic acid; Vitamin B<sub>9</sub>; Vitamin B<sub>c</sub>;Vitamin M; Folacin
| Section1 = {{Chembox Identifiers
|PubChem=6037
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00158
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27470
| SMILES = c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCc2cnc3c(n2)c(=O)nc([nH]3)N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5815
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 935E97BOY8
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1622
| InChI = 1/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1
| InChIKey = OVBPIULPVIDEAO-LBPRGKRZBH
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N
| CASNo = 59-30-3
| CASNo_Ref = {{cascite|correct|CAS}}
| ATCCode_prefix = B03
| ATCCode_suffix = BB01
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C00504
| RTECS = LP5425000
}}
| Section2 = {{Chembox Properties
| C=19 | H=19 | N=7 | O=6
| Appearance = yellow-orange crystalline powder
| Density =
| Solubility = 1.6 mg/L (25 °C)<ref name=chemid>{{ChemID|59-30-3}}</ref>
| MeltingPt = 250 °C (523 K), [[Chemical decomposition|decomp.]]<ref name=chemid/>
| pKa = 1<sup>st</sup>: 4.65, 2<sup>nd</sup>: 6.75, 3<sup>rd</sup>: 9.00<ref>R. M. C. Dawson: ''Data for Biochemical Research'', Oxford University Press, Oxford, 1989, 3<sub>rd</sub> Edition, p.&nbsp;134, ISBN 0-19-855299-8.</ref>
}}
| Section7 = {{Chembox Hazards
| MainHazards =
}}
}}
'''Фолната киселина''' (позната и како '''витамин B<sub>9</sub>'''<ref>{{цитирана веб страница | last = Ural | first = Serdar H. | title = Folic Acid and Pregnancy. | publisher = Kid's Health | date = 2008-11 | url = http://kidshealth.org/parent/pregnancy_newborn/pregnancy/folic_acid.html }}</ref> или '''фолацин''') и '''фолатот''' (природната форма), како и '''птероил-[[Глутаминска киселина|L-глутаминската киселина]]''' и '''птероил-[[Глутамат|L-глутамат]]от''' се [[Хемиска формула|форми]] на водорастворливиот [[Витамин B|витамин B<sub>9</sub>]]. Овој витамин е [[есенцијална хранлива состојка]] и е важен за многу процеси, како [[биосинтеза]] на [[нуклеотид]]и и ре[[метилација]] на [[хомоцистеин]]. Тој е особено важен во периодите на брза [[делба на клетките]] и раст. На возрасните и децата им е потребен овој витамин за создавање на здрави [[еритроцит]]и и за спречување на [[анемија]].<ref>{{цитирана веб страница | title = Dietary Supplement Fact Sheet: Folate. | publisher = Office of Dietary Supplements, National Institutes of Health | url = http://ods.od.nih.gov/factsheets/folate.asp }}</ref> Името доаѓа од [[латински]]от збор ''folium'' што значи ''лист''.